C30H30N4O5 — CID 42785371
[1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42785371) has the molecular formula C30H30N4O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42785371 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2C)c(OC)c1 |
| InChI | InChI=1S/C30H30N4O5/c1-21-26(30(35)32-17-15-31(16-18-32)23-9-11-24(12-10-23)34(36)37)20-28(22-7-5-4-6-8-22)33(21)27-14-13-25(38-2)19-29(27)39-3/h4-14,19-20H,15-18H2,1-3H3 |
| InChIKey | PWUBBIBVLVKFTP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 90.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|