C29H24F2N4O4 — CID 42789043
[4-[1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42789043) has the molecular formula C29H24F2N4O4 and a molecular weight of 530.53 g/mol. Its IUPAC name is [4-[1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42789043 |
| Molecular Formula | C29H24F2N4O4 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [4-[1-(2,4-difluorophenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)cc(-c2ccccc2)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C29H24F2N4O4/c1-19-24(18-27(20-5-3-2-4-6-20)34(19)26-12-9-22(30)17-25(26)31)29(37)33-15-13-32(14-16-33)28(36)21-7-10-23(11-8-21)35(38)39/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | YSFKGBHIJPGFCD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|