C36H31F2N3O3 — CID 42666461
[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 42666461) has the molecular formula C36H31F2N3O3 and a molecular weight of 591.66 g/mol. Its IUPAC name is [4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 42666461 |
| Molecular Formula | C36H31F2N3O3 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | [4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)c(C)n2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C36H31F2N3O3/c1-24-31(23-34(27-12-15-30(44-2)16-13-27)41(24)33-17-14-29(37)22-32(33)38)36(43)40-20-18-39(19-21-40)35(42)28-10-8-26(9-11-28)25-6-4-3-5-7-25/h3-17,22-23H,18-21H2,1-2H3 |
| InChIKey | KEEQHOKLGYPSOZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|