C31H31FN2O2 — CID 42785490
(4-benzylpiperidin-1-yl)-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone (PubChem CID 42785490) has the molecular formula C31H31FN2O2 and a molecular weight of 482.60 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 42785490 |
| Molecular Formula | C31H31FN2O2 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCC(Cc4ccccc4)CC3)c(C)n2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C31H31FN2O2/c1-22-27(31(35)33-18-16-24(17-19-33)20-23-8-4-3-5-9-23)21-30(25-12-14-26(36-2)15-13-25)34(22)29-11-7-6-10-28(29)32/h3-15,21,24H,16-20H2,1-2H3 |
| InChIKey | PILZBAAODBKLBB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|