C32H34N2O3 — CID 42665829
(4-benzylpiperidin-1-yl)-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone (PubChem CID 42665829) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 42665829 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCC(Cc4ccccc4)CC3)c(C)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-23-30(32(35)33-18-16-25(17-19-33)20-24-8-5-4-6-9-24)22-31(26-12-14-28(36-2)15-13-26)34(23)27-10-7-11-29(21-27)37-3/h4-15,21-22,25H,16-20H2,1-3H3 |
| InChIKey | QRQWPZNMRZMJPX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|