C30H36N4O3 — CID 42792081
N-cyclohexyl-4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 42792081) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-cyclohexyl-4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42792081 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-cyclohexyl-4-[5-(4-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)NC4CCCCC4)CC3)c(C)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O3/c1-22-27(29(35)32-17-19-33(20-18-32)30(36)31-24-9-5-3-6-10-24)21-28(23-13-15-26(37-2)16-14-23)34(22)25-11-7-4-8-12-25/h4,7-8,11-16,21,24H,3,5-6,9-10,17-20H2,1-2H3,(H,31,36) |
| InChIKey | PDBPLNWKUJVCLS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|