C31H32N4O3 — CID 42789154
4-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 42789154) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is 4-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42789154 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-[5-(3-methoxyphenyl)-2-methyl-1-phenylpyrrole-3-carbonyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(C(=O)Nc4ccc(C)cc4)CC3)c(C)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C31H32N4O3/c1-22-12-14-25(15-13-22)32-31(37)34-18-16-33(17-19-34)30(36)28-21-29(24-8-7-11-27(20-24)38-3)35(23(28)2)26-9-5-4-6-10-26/h4-15,20-21H,16-19H2,1-3H3,(H,32,37) |
| InChIKey | RBCZZLIEINSMPP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|