C32H34N4O6S — CID 3971348
N-[4-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 3971348) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is N-[4-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 3971348 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | N-[4-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(S(=O)(=O)c4ccc(NC(C)=O)cc4)CC3)c(C)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C32H34N4O6S/c1-22-30(21-31(24-8-12-27(41-3)13-9-24)36(22)26-6-5-7-28(20-26)42-4)32(38)34-16-18-35(19-17-34)43(39,40)29-14-10-25(11-15-29)33-23(2)37/h5-15,20-21H,16-19H2,1-4H3,(H,33,37) |
| InChIKey | VLPWLCFURZRMFQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|