C33H34N4O5 — CID 3907258
ethyl 4-[[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 3907258) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is ethyl 4-[[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3907258 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | ethyl 4-[[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCN(C(=O)c3cc(-c4ccccc4)n(-c4cccc(OC)c4)c3C)CC2)cc1 |
| InChI | InChI=1S/C33H34N4O5/c1-4-42-32(39)25-13-15-26(16-14-25)34-33(40)36-19-17-35(18-20-36)31(38)29-22-30(24-9-6-5-7-10-24)37(23(29)2)27-11-8-12-28(21-27)41-3/h5-16,21-22H,4,17-20H2,1-3H3,(H,34,40) |
| InChIKey | NYVBTXFHGOPYFR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|