C36H41N3O3 — CID 4212772
(4-hexylphenyl)-[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]methanone (PubChem CID 4212772) has the molecular formula C36H41N3O3 and a molecular weight of 563.74 g/mol. Its IUPAC name is (4-hexylphenyl)-[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]methanone.
| Compound Name | (4-hexylphenyl)-[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4212772 |
| Molecular Formula | C36H41N3O3 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | (4-hexylphenyl)-[4-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperazin-1-yl]methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccccc4)n(-c4cccc(OC)c4)c3C)CC2)cc1 |
| InChI | InChI=1S/C36H41N3O3/c1-4-5-6-8-12-28-17-19-30(20-18-28)35(40)37-21-23-38(24-22-37)36(41)33-26-34(29-13-9-7-10-14-29)39(27(33)2)31-15-11-16-32(25-31)42-3/h7,9-11,13-20,25-26H,4-6,8,12,21-24H2,1-3H3 |
| InChIKey | MAXJGRZBRVXNCC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|