C34H45N3O4 — CID 42792061
1-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one (PubChem CID 42792061) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is 1-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one.
| Compound Name | 1-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one |
|---|---|
| PubChem CID | 42792061 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | 1-[4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CCN(C(=O)c2cc(-c3ccc(OC)cc3)n(-c3cccc(OC)c3)c2C)CC1 |
| InChI | InChI=1S/C34H45N3O4/c1-5-6-7-8-9-10-11-15-33(38)35-20-22-36(23-21-35)34(39)31-25-32(27-16-18-29(40-3)19-17-27)37(26(31)2)28-13-12-14-30(24-28)41-4/h12-14,16-19,24-25H,5-11,15,20-23H2,1-4H3 |
| InChIKey | MJVKEGIELUEPPF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|