C31H30ClN3O4 — CID 4570149
1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone (PubChem CID 4570149) has the molecular formula C31H30ClN3O4 and a molecular weight of 544.05 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 4570149 |
| Molecular Formula | C31H30ClN3O4 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
| SMILES | COc1ccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)N3CCN(C(=O)COc4ccccc4)CC3)c2C)cc1 |
| InChI | InChI=1S/C31H30ClN3O4/c1-22-28(31(37)34-18-16-33(17-19-34)30(36)21-39-27-6-4-3-5-7-27)20-29(23-8-10-24(32)11-9-23)35(22)25-12-14-26(38-2)15-13-25/h3-15,20H,16-19,21H2,1-2H3 |
| InChIKey | JMNYOONESVYZQR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|