C31H38N4O4 — CID 4256960
N-cyclohexyl-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 4256960) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-cyclohexyl-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 4256960 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-cyclohexyl-4-[1-(3-methoxyphenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)NC4CCCCC4)CC3)c(C)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C31H38N4O4/c1-22-28(30(36)33-16-18-34(19-17-33)31(37)32-24-8-5-4-6-9-24)21-29(23-12-14-26(38-2)15-13-23)35(22)25-10-7-11-27(20-25)39-3/h7,10-15,20-21,24H,4-6,8-9,16-19H2,1-3H3,(H,32,37) |
| InChIKey | GASJFJXPCCNYND-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|