C30H35FN4O2 — CID 42666402
N-cyclohexyl-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide (PubChem CID 42666402) has the molecular formula C30H35FN4O2 and a molecular weight of 502.63 g/mol. Its IUPAC name is N-cyclohexyl-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42666402 |
| Molecular Formula | C30H35FN4O2 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-cyclohexyl-4-[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrole-3-carbonyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)cc(C(=O)N3CCN(C(=O)NC4CCCCC4)CC3)c2C)cc1 |
| InChI | InChI=1S/C30H35FN4O2/c1-21-8-14-26(15-9-21)35-22(2)27(20-28(35)23-10-12-24(31)13-11-23)29(36)33-16-18-34(19-17-33)30(37)32-25-6-4-3-5-7-25/h8-15,20,25H,3-7,16-19H2,1-2H3,(H,32,37) |
| InChIKey | RDNBVGOVCGRAGH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|