C30H30FN3O2 — CID 42785291
[5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrol-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42785291) has the molecular formula C30H30FN3O2 and a molecular weight of 483.59 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrol-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrol-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42785291 |
| Molecular Formula | C30H30FN3O2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [5-(4-fluorophenyl)-2-methyl-1-(4-methylphenyl)pyrrol-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(-c4ccc(F)cc4)n(-c4ccc(C)cc4)c3C)CC2)cc1 |
| InChI | InChI=1S/C30H30FN3O2/c1-21-4-10-26(11-5-21)34-22(2)28(20-29(34)23-6-8-24(31)9-7-23)30(35)33-18-16-32(17-19-33)25-12-14-27(36-3)15-13-25/h4-15,20H,16-19H2,1-3H3 |
| InChIKey | NLOAYLRDMVSZRH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|