C24H24F2N2O2 — CID 42785550
[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-piperidin-1-ylmethanone (PubChem CID 42785550) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is [1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42785550 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrol-3-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCCCC3)c(C)n2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C24H24F2N2O2/c1-16-20(24(29)27-12-4-3-5-13-27)15-23(17-6-9-19(30-2)10-7-17)28(16)22-11-8-18(25)14-21(22)26/h6-11,14-15H,3-5,12-13H2,1-2H3 |
| InChIKey | NICFUAJATUGVAE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|