C28H30ClF2N3O3 — CID 42666459
3-chloro-1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 42666459) has the molecular formula C28H30ClF2N3O3 and a molecular weight of 530.02 g/mol. Its IUPAC name is 3-chloro-1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 42666459 |
| Molecular Formula | C28H30ClF2N3O3 |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3-chloro-1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)C(C)(C)CCl)CC3)c(C)n2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C28H30ClF2N3O3/c1-18-22(26(35)32-11-13-33(14-12-32)27(36)28(2,3)17-29)16-25(19-5-8-21(37-4)9-6-19)34(18)24-10-7-20(30)15-23(24)31/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | CBEKEJGWILCSMX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|