C32H31F2N3O3 — CID 42666460
1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 42666460) has the molecular formula C32H31F2N3O3 and a molecular weight of 543.61 g/mol. Its IUPAC name is 1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 42666460 |
| Molecular Formula | C32H31F2N3O3 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-[4-[1-(2,4-difluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(=O)CCc4ccccc4)CC3)c(C)n2-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C32H31F2N3O3/c1-22-27(32(39)36-18-16-35(17-19-36)31(38)15-8-23-6-4-3-5-7-23)21-30(24-9-12-26(40-2)13-10-24)37(22)29-14-11-25(33)20-28(29)34/h3-7,9-14,20-21H,8,15-19H2,1-2H3 |
| InChIKey | KKIUNRGIFVJXHE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|