C33H42FN3O3 — CID 42791971
1-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one (PubChem CID 42791971) has the molecular formula C33H42FN3O3 and a molecular weight of 547.72 g/mol. Its IUPAC name is 1-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one.
| Compound Name | 1-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one |
|---|---|
| PubChem CID | 42791971 |
| Molecular Formula | C33H42FN3O3 |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 1-[4-[1-(2-fluorophenyl)-5-(4-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CCN(C(=O)c2cc(-c3ccc(OC)cc3)n(-c3ccccc3F)c2C)CC1 |
| InChI | InChI=1S/C33H42FN3O3/c1-4-5-6-7-8-9-10-15-32(38)35-20-22-36(23-21-35)33(39)28-24-31(26-16-18-27(40-3)19-17-26)37(25(28)2)30-14-12-11-13-29(30)34/h11-14,16-19,24H,4-10,15,20-23H2,1-3H3 |
| InChIKey | NNZNRCGZWDZTLL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|