C24H23ClFN3O2 — CID 24718477
1-[4-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone (PubChem CID 24718477) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.92 g/mol. Its IUPAC name is 1-[4-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24718477 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[4-[5-(4-chlorophenyl)-1-(2-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccccc3F)c2C)CC1 |
| InChI | InChI=1S/C24H23ClFN3O2/c1-16-20(24(31)28-13-11-27(12-14-28)17(2)30)15-23(18-7-9-19(25)10-8-18)29(16)22-6-4-3-5-21(22)26/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | KICBNEQWPHZVBK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|