C30H28ClN3O2 — CID 3899954
[4-[5-(4-chlorophenyl)-2-methyl-1-(3-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-phenylmethanone (PubChem CID 3899954) has the molecular formula C30H28ClN3O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is [4-[5-(4-chlorophenyl)-2-methyl-1-(3-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[5-(4-chlorophenyl)-2-methyl-1-(3-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 3899954 |
| Molecular Formula | C30H28ClN3O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | [4-[5-(4-chlorophenyl)-2-methyl-1-(3-methylphenyl)pyrrole-3-carbonyl]piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1cccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)N3CCN(C(=O)c4ccccc4)CC3)c2C)c1 |
| InChI | InChI=1S/C30H28ClN3O2/c1-21-7-6-10-26(19-21)34-22(2)27(20-28(34)23-11-13-25(31)14-12-23)30(36)33-17-15-32(16-18-33)29(35)24-8-4-3-5-9-24/h3-14,19-20H,15-18H2,1-2H3 |
| InChIKey | OPGDBZXQGWYDMR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|