C24H22Cl2FN3O2 — CID 4620719
2-chloro-1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone (PubChem CID 4620719) has the molecular formula C24H22Cl2FN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is 2-chloro-1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4620719 |
| Molecular Formula | C24H22Cl2FN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-chloro-1-[4-[5-(4-chlorophenyl)-1-(3-fluorophenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]ethanone |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)CCl)CC2)cc(-c2ccc(Cl)cc2)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C24H22Cl2FN3O2/c1-16-21(24(32)29-11-9-28(10-12-29)23(31)15-25)14-22(17-5-7-18(26)8-6-17)30(16)20-4-2-3-19(27)13-20/h2-8,13-14H,9-12,15H2,1H3 |
| InChIKey | RHTOZRLNJZIXPT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|