C22H22ClFN2O2 — CID 7218711
5-(4-chlorophenyl)-1-(3-fluorophenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide (PubChem CID 7218711) has the molecular formula C22H22ClFN2O2 and a molecular weight of 400.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(3-fluorophenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(3-fluorophenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7218711 |
| Molecular Formula | C22H22ClFN2O2 |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(3-fluorophenyl)-N-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
| SMILES | COCCCNC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2cccc(F)c2)c1C |
| InChI | InChI=1S/C22H22ClFN2O2/c1-15-20(22(27)25-11-4-12-28-2)14-21(16-7-9-17(23)10-8-16)26(15)19-6-3-5-18(24)13-19/h3,5-10,13-14H,4,11-12H2,1-2H3,(H,25,27) |
| InChIKey | BPXMFMNRDRHUSL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|