C22H24ClFN3O+ — CID 7306703
2-[[5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrole-3-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 7306703) has the molecular formula C22H24ClFN3O+ and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrole-3-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrole-3-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7306703 |
| Molecular Formula | C22H24ClFN3O+ |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1-(4-fluorophenyl)-2-methylpyrrole-3-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | Cc1c(C(=O)NCC[NH+](C)C)cc(-c2ccc(Cl)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23ClFN3O/c1-15-20(22(28)25-12-13-26(2)3)14-21(16-4-6-17(23)7-5-16)27(15)19-10-8-18(24)9-11-19/h4-11,14H,12-13H2,1-3H3,(H,25,28)/p+1 |
| InChIKey | QDTOFRARAPYRGW-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 38.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|