C26H30ClN3O2 — CID 42785629
5-(4-chlorophenyl)-2-methyl-1-(4-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyrrole-3-carboxamide (PubChem CID 42785629) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-1-(4-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-1-(4-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42785629 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-1-(4-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyrrole-3-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(Cl)cc3)cc(C(=O)NCCCN3CCOCC3)c2C)cc1 |
| InChI | InChI=1S/C26H30ClN3O2/c1-19-4-10-23(11-5-19)30-20(2)24(18-25(30)21-6-8-22(27)9-7-21)26(31)28-12-3-13-29-14-16-32-17-15-29/h4-11,18H,3,12-17H2,1-2H3,(H,28,31) |
| InChIKey | XJVWLDDJUNXTKD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|