C22H25ClN4O3S — CID 24894444
5-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide (PubChem CID 24894444) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24894444 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCN(C)C)cc(-c2ccc(Cl)cc2)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-15-20(22(28)25-12-13-26(2)3)14-21(16-4-6-17(23)7-5-16)27(15)18-8-10-19(11-9-18)31(24,29)30/h4-11,14H,12-13H2,1-3H3,(H,25,28)(H2,24,29,30) |
| InChIKey | PHUHDUWZIUMHLX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|