C18H14ClN2O4S- — CID 24894219
5-(4-chlorophenyl)-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate (PubChem CID 24894219) has the molecular formula C18H14ClN2O4S- and a molecular weight of 389.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 24894219 |
| Molecular Formula | C18H14ClN2O4S- |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-1-(4-sulfamoylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1c(C(=O)[O-])cc(-c2ccc(Cl)cc2)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H15ClN2O4S/c1-11-16(18(22)23)10-17(12-2-4-13(19)5-3-12)21(11)14-6-8-15(9-7-14)26(20,24)25/h2-10H,1H3,(H,22,23)(H2,20,24,25)/p-1 |
| InChIKey | MLVCEWBLMXMCLO-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|