C20H21ClN4O3S — CID 22315560
N-tert-butyl-5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide (PubChem CID 22315560) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol. Its IUPAC name is N-tert-butyl-5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-tert-butyl-5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 22315560 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-tert-butyl-5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C20H21ClN4O3S/c1-20(2,3)23-19(26)17-12-18(13-4-6-14(21)7-5-13)25(24-17)15-8-10-16(11-9-15)29(22,27)28/h4-12H,1-3H3,(H,23,26)(H2,22,27,28) |
| InChIKey | BRKYAWFQODHPNU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |