C16H14ClN3O4S2 — CID 137462338
[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methanesulfinic acid (PubChem CID 137462338) has the molecular formula C16H14ClN3O4S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methanesulfinic acid.
| Compound Name | [5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 137462338 |
| Molecular Formula | C16H14ClN3O4S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methanesulfinic acid |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(CS(=O)O)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14ClN3O4S2/c17-12-3-1-11(2-4-12)16-9-13(10-25(21)22)19-20(16)14-5-7-15(8-6-14)26(18,23)24/h1-9H,10H2,(H,21,22)(H2,18,23,24) |
| InChIKey | UENKSSZJIDJMEO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|