C21H19Cl2N3O2S2 — CID 142913120
4-[5-(4-chlorophenyl)-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]benzenesulfonamide;ethane (PubChem CID 142913120) has the molecular formula C21H19Cl2N3O2S2 and a molecular weight of 480.44 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]benzenesulfonamide;ethane.
| Compound Name | 4-[5-(4-chlorophenyl)-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]benzenesulfonamide;ethane |
|---|---|
| PubChem CID | 142913120 |
| Molecular Formula | C21H19Cl2N3O2S2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-3-(5-chlorothiophen-2-yl)pyrazol-1-yl]benzenesulfonamide;ethane |
| SMILES | CC.NS(=O)(=O)c1ccc(-n2nc(-c3ccc(Cl)s3)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H13Cl2N3O2S2.C2H6/c20-13-3-1-12(2-4-13)17-11-16(18-9-10-19(21)27-18)23-24(17)14-5-7-15(8-6-14)28(22,25)26;1-2/h1-11H,(H2,22,25,26);1-2H3 |
| InChIKey | DGFPBQKIXKZGKM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |