C18H15ClN4O5S — CID 10003065
2-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]acetic acid (PubChem CID 10003065) has the molecular formula C18H15ClN4O5S and a molecular weight of 434.86 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 10003065 |
| Molecular Formula | C18H15ClN4O5S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(=O)NCC(=O)O)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H15ClN4O5S/c19-12-3-1-11(2-4-12)16-9-15(18(26)21-10-17(24)25)22-23(16)13-5-7-14(8-6-13)29(20,27)28/h1-9H,10H2,(H,21,26)(H,24,25)(H2,20,27,28) |
| InChIKey | IEYRWFZMBDMJJW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |