C46H34Br2Cl2N8O9PS2+ — CID 175023474
bis[(4-bromophenyl)-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium (PubChem CID 175023474) has the molecular formula C46H34Br2Cl2N8O9PS2+ and a molecular weight of 1168.65 g/mol. Its IUPAC name is bis[(4-bromophenyl)-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium.
| Compound Name | bis[(4-bromophenyl)-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175023474 |
| Molecular Formula | C46H34Br2Cl2N8O9PS2+ |
| Molecular Weight | 1168.65 g/mol |
| Exact Mass | 1164.94 |
| IUPAC Name | bis[(4-bromophenyl)-[[5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(=O)NC(O[P+](=O)OC(NC(=O)c3cc(-c4ccc(Cl)cc4)n(-c4ccc(S(N)(=O)=O)cc4)n3)c3ccc(Br)cc3)c3ccc(Br)cc3)cc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C46H33Br2Cl2N8O9PS2/c47-31-9-1-29(2-10-31)45(53-43(59)39-25-41(27-5-13-33(49)14-6-27)57(55-39)35-17-21-37(22-18-35)69(51,62)63)66-68(61)67-46(30-3-11-32(48)12-4-30)54-44(60)40-26-42(28-7-15-34(50)16-8-28)58(56-40)36-19-23-38(24-20-36)70(52,64)65/h1-26,45-46H,(H5-,51,52,53,54,59,60,62,63,64,65)/p+1 |
| InChIKey | URBBECVPURHJSA-UHFFFAOYSA-O |
| XLogP | 9.77 |
| TPSA | 249.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.65 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|