C48H40Br2N8O11PS2+ — CID 175018714
bis[(4-bromophenyl)-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium (PubChem CID 175018714) has the molecular formula C48H40Br2N8O11PS2+ and a molecular weight of 1159.81 g/mol. Its IUPAC name is bis[(4-bromophenyl)-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium.
| Compound Name | bis[(4-bromophenyl)-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175018714 |
| Molecular Formula | C48H40Br2N8O11PS2+ |
| Molecular Weight | 1159.81 g/mol |
| Exact Mass | 1157.04 |
| IUPAC Name | bis[(4-bromophenyl)-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carbonyl]amino]methoxy]-oxophosphanium |
| SMILES | COc1ccc(-c2cc(C(=O)NC(O[P+](=O)OC(NC(=O)c3cc(-c4ccc(OC)cc4)n(-c4ccc(S(N)(=O)=O)cc4)n3)c3ccc(Br)cc3)c3ccc(Br)cc3)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C48H39Br2N8O11PS2/c1-66-37-19-7-29(8-20-37)43-27-41(55-57(43)35-15-23-39(24-16-35)71(51,62)63)45(59)53-47(31-3-11-33(49)12-4-31)68-70(61)69-48(32-5-13-34(50)14-6-32)54-46(60)42-28-44(30-9-21-38(67-2)22-10-30)58(56-42)36-17-25-40(26-18-36)72(52,64)65/h3-28,47-48H,1-2H3,(H5-,51,52,53,54,59,60,62,63,64,65)/p+1 |
| InChIKey | GPYYRFRANSLNDN-UHFFFAOYSA-O |
| XLogP | 8.48 |
| TPSA | 268.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|