C18H19N5O5S — CID 87973346
1-hydroxy-1-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]urea (PubChem CID 87973346) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is 1-hydroxy-1-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]urea.
| Compound Name | 1-hydroxy-1-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 87973346 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 1-hydroxy-1-[[5-(4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]urea |
| SMILES | COc1ccc(-c2cc(CN(O)C(N)=O)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H19N5O5S/c1-28-15-6-2-12(3-7-15)17-10-13(11-22(25)18(19)24)21-23(17)14-4-8-16(9-5-14)29(20,26)27/h2-10,25H,11H2,1H3,(H2,19,24)(H2,20,26,27) |
| InChIKey | MDEGHWBNNRZBBW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|