C13H16N4O4S — CID 22959188
1-hydroxy-1-[[5-methyl-1-(4-methylsulfonylphenyl)pyrazol-3-yl]methyl]urea (PubChem CID 22959188) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is 1-hydroxy-1-[[5-methyl-1-(4-methylsulfonylphenyl)pyrazol-3-yl]methyl]urea.
| Compound Name | 1-hydroxy-1-[[5-methyl-1-(4-methylsulfonylphenyl)pyrazol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 22959188 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-hydroxy-1-[[5-methyl-1-(4-methylsulfonylphenyl)pyrazol-3-yl]methyl]urea |
| SMILES | Cc1cc(CN(O)C(N)=O)nn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N4O4S/c1-9-7-10(8-16(19)13(14)18)15-17(9)11-3-5-12(6-4-11)22(2,20)21/h3-7,19H,8H2,1-2H3,(H2,14,18) |
| InChIKey | PLKGKCNKVOGPSR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|