C18H18ClN5O5S — CID 87973466
1-[[5-(3-chloro-4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]-1-hydroxyurea (PubChem CID 87973466) has the molecular formula C18H18ClN5O5S and a molecular weight of 451.89 g/mol. Its IUPAC name is 1-[[5-(3-chloro-4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[5-(3-chloro-4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 87973466 |
| Molecular Formula | C18H18ClN5O5S |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 1-[[5-(3-chloro-4-methoxyphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]methyl]-1-hydroxyurea |
| SMILES | COc1ccc(-c2cc(CN(O)C(N)=O)nn2-c2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C18H18ClN5O5S/c1-29-17-7-2-11(8-15(17)19)16-9-12(10-23(26)18(20)25)22-24(16)13-3-5-14(6-4-13)30(21,27)28/h2-9,26H,10H2,1H3,(H2,20,25)(H2,21,27,28) |
| InChIKey | HFMQKXHQWZSZBU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|