C18H18F2N3O3PS — CID 143009192
4-[5-(3-fluoro-4-methoxyphenyl)-3-(1-fluoro-1-phosphanylethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 143009192) has the molecular formula C18H18F2N3O3PS and a molecular weight of 425.40 g/mol. Its IUPAC name is 4-[5-(3-fluoro-4-methoxyphenyl)-3-(1-fluoro-1-phosphanylethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-(3-fluoro-4-methoxyphenyl)-3-(1-fluoro-1-phosphanylethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143009192 |
| Molecular Formula | C18H18F2N3O3PS |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-[5-(3-fluoro-4-methoxyphenyl)-3-(1-fluoro-1-phosphanylethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(C(C)(F)P)nn2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C18H18F2N3O3PS/c1-18(20,27)17-10-15(11-3-8-16(26-2)14(19)9-11)23(22-17)12-4-6-13(7-5-12)28(21,24)25/h3-10H,27H2,1-2H3,(H2,21,24,25) |
| InChIKey | YWRSEURXJDOQGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|