C19H16FNO3S — CID 10808251
4-[2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide (PubChem CID 10808251) has the molecular formula C19H16FNO3S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide.
| Compound Name | 4-[2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10808251 |
| Molecular Formula | C19H16FNO3S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-[2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2ccccc2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C19H16FNO3S/c1-24-19-11-8-14(12-18(19)20)17-5-3-2-4-16(17)13-6-9-15(10-7-13)25(21,22)23/h2-12H,1H3,(H2,21,22,23) |
| InChIKey | VLZYADILQZRSFD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |