C23H25FN2O5S — CID 23218036
4-[2-butoxy-6-(3-fluoro-4-methoxyphenyl)-3-(hydroxymethyl)-4-pyridinyl]benzenesulfonamide (PubChem CID 23218036) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[2-butoxy-6-(3-fluoro-4-methoxyphenyl)-3-(hydroxymethyl)-4-pyridinyl]benzenesulfonamide.
| Compound Name | 4-[2-butoxy-6-(3-fluoro-4-methoxyphenyl)-3-(hydroxymethyl)-4-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23218036 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-[2-butoxy-6-(3-fluoro-4-methoxyphenyl)-3-(hydroxymethyl)-4-pyridinyl]benzenesulfonamide |
| SMILES | CCCCOc1nc(-c2ccc(OC)c(F)c2)cc(-c2ccc(S(N)(=O)=O)cc2)c1CO |
| InChI | InChI=1S/C23H25FN2O5S/c1-3-4-11-31-23-19(14-27)18(15-5-8-17(9-6-15)32(25,28)29)13-21(26-23)16-7-10-22(30-2)20(24)12-16/h5-10,12-13,27H,3-4,11,14H2,1-2H3,(H2,25,28,29) |
| InChIKey | SICWDKGYMHJVEM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|