C14H22FNO3S — CID 43342399
3-fluoro-4-octoxybenzenesulfonamide (PubChem CID 43342399) has the molecular formula C14H22FNO3S and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-fluoro-4-octoxybenzenesulfonamide.
| Compound Name | 3-fluoro-4-octoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43342399 |
| Molecular Formula | C14H22FNO3S |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-fluoro-4-octoxybenzenesulfonamide |
| SMILES | CCCCCCCCOc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C14H22FNO3S/c1-2-3-4-5-6-7-10-19-14-9-8-12(11-13(14)15)20(16,17)18/h8-9,11H,2-7,10H2,1H3,(H2,16,17,18) |
| InChIKey | HSPGOWDXEWRYBP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|