C10H15FN2O3S — CID 82921210
4-[2-(dimethylamino)ethoxy]-3-fluorobenzenesulfonamide (PubChem CID 82921210) has the molecular formula C10H15FN2O3S and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 82921210 |
| Molecular Formula | C10H15FN2O3S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-3-fluorobenzenesulfonamide |
| SMILES | CN(C)CCOc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H15FN2O3S/c1-13(2)5-6-16-10-4-3-8(7-9(10)11)17(12,14)15/h3-4,7H,5-6H2,1-2H3,(H2,12,14,15) |
| InChIKey | XREOAXCYTGVAIN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |