C10H14FNO4S — CID 43457341
4-(2-ethoxyethoxy)-3-fluorobenzenesulfonamide (PubChem CID 43457341) has the molecular formula C10H14FNO4S and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(2-ethoxyethoxy)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43457341 |
| Molecular Formula | C10H14FNO4S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 4-(2-ethoxyethoxy)-3-fluorobenzenesulfonamide |
| SMILES | CCOCCOc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H14FNO4S/c1-2-15-5-6-16-10-4-3-8(7-9(10)11)17(12,13)14/h3-4,7H,2,5-6H2,1H3,(H2,12,13,14) |
| InChIKey | JDGVLXBNVBRZBD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|