C13H20FN3O3S — CID 82913717
3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzenesulfonamide (PubChem CID 82913717) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82913717 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-fluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzenesulfonamide |
| SMILES | CN1CCN(CCOc2ccc(S(N)(=O)=O)cc2F)CC1 |
| InChI | InChI=1S/C13H20FN3O3S/c1-16-4-6-17(7-5-16)8-9-20-13-3-2-11(10-12(13)14)21(15,18)19/h2-3,10H,4-9H2,1H3,(H2,15,18,19) |
| InChIKey | QUZOSFOZMVYBAZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |