C20H26ClN3O4S — CID 34704622
4-[2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]ethoxy]benzenesulfonamide (PubChem CID 34704622) has the molecular formula C20H26ClN3O4S and a molecular weight of 439.97 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 34704622 |
| Molecular Formula | C20H26ClN3O4S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-[2-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCN2CCN(CCOc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H26ClN3O4S/c21-17-1-3-18(4-2-17)27-15-13-23-9-11-24(12-10-23)14-16-28-19-5-7-20(8-6-19)29(22,25)26/h1-8H,9-16H2,(H2,22,25,26) |
| InChIKey | PBSMJROOEWEILW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |