C12H18N2O4S — CID 78962070
4-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethoxy]benzenesulfonamide (PubChem CID 78962070) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 78962070 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCN2CC[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c13-19(16,17)12-3-1-11(2-4-12)18-8-7-14-6-5-10(15)9-14/h1-4,10,15H,5-9H2,(H2,13,16,17)/t10-/m1/s1 |
| InChIKey | OLIZUFCNRWGYNI-SNVBAGLBSA-N |
| XLogP | -0.22 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |