C17H27N3O5S — CID 46594465
tert-butyl 4-[2-(4-sulfamoylphenoxy)ethyl]piperazine-1-carboxylate (PubChem CID 46594465) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-sulfamoylphenoxy)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-sulfamoylphenoxy)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46594465 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | tert-butyl 4-[2-(4-sulfamoylphenoxy)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCOc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O5S/c1-17(2,3)25-16(21)20-10-8-19(9-11-20)12-13-24-14-4-6-15(7-5-14)26(18,22)23/h4-7H,8-13H2,1-3H3,(H2,18,22,23) |
| InChIKey | QUNCPIUZUDSQJX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |