C20H24N4O3S — CID 78896382
4-[4-[3-(4-cyanophenoxy)propyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 78896382) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-[4-[3-(4-cyanophenoxy)propyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[3-(4-cyanophenoxy)propyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 78896382 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[4-[3-(4-cyanophenoxy)propyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(OCCCN2CCN(c3ccc(S(N)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O3S/c21-16-17-2-6-19(7-3-17)27-15-1-10-23-11-13-24(14-12-23)18-4-8-20(9-5-18)28(22,25)26/h2-9H,1,10-15H2,(H2,22,25,26) |
| InChIKey | LVJSGFRHRSLIQB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|