C14H18N2O3S — CID 43581427
4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzonitrile (PubChem CID 43581427) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzonitrile.
| Compound Name | 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43581427 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c15-12-13-2-4-14(5-3-13)19-9-1-6-16-7-10-20(17,18)11-8-16/h2-5H,1,6-11H2 |
| InChIKey | WNFDESYUFTXDQX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|