C13H16N2O3S — CID 43581422
4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]benzonitrile (PubChem CID 43581422) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]benzonitrile.
| Compound Name | 4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 43581422 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H16N2O3S/c14-11-12-1-3-13(4-2-12)18-8-5-15-6-9-19(16,17)10-7-15/h1-4H,5-10H2 |
| InChIKey | XTMXTGWMOLPSPN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |