C13H20N2O3S — CID 43581114
2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]aniline (PubChem CID 43581114) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]aniline.
| Compound Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]aniline |
|---|---|
| PubChem CID | 43581114 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]aniline |
| SMILES | Nc1ccccc1OCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H20N2O3S/c14-12-4-1-2-5-13(12)18-9-3-6-15-7-10-19(16,17)11-8-15/h1-2,4-5H,3,6-11,14H2 |
| InChIKey | JMDUWOWPQKZFJU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|